CAS 332-25-2
:4-(Trifluoromethoxy)benzonitrile
Description:
4-(Trifluoromethoxy)benzonitrile, with the CAS number 332-25-2, is an organic compound characterized by the presence of a benzonitrile moiety substituted with a trifluoromethoxy group at the para position. This compound features a benzene ring attached to a nitrile group (-C≡N) and a trifluoromethoxy group (-O-CF3), which significantly influences its chemical properties. The trifluoromethoxy group enhances the compound's lipophilicity and can affect its reactivity and interaction with biological systems. 4-(Trifluoromethoxy)benzonitrile is typically a solid at room temperature and is known for its stability under various conditions. It may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethoxy group, making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, its unique structure allows for potential use in material science and as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H4F3NO
InChI:InChI=1S/C8H4F3NO/c9-8(10,11)13-7-3-1-6(5-12)2-4-7/h1-4H
InChI key:InChIKey=XWHIXOMWXCHJPP-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC=C(C#N)C=C1
Synonyms:- 4-(Trifluoromethoxy)Benzonitrile
- 4-Cyanophenyl trifluoromethyl ether
- 4-[(Trifluoromethyl)sulfanyl]benzonitrile
- Benzonitrile, 4-(trifluoromethoxy)-
- Benzonitrile, 4-[(Trifluoromethyl)Thio]-
- p-Anisonitrile, α,α,α-trifluoro-
- p-Trifluoromethoxybenzonitrile
- p-Trifluoromethyloxybenzonitrile
- α,α,α-Trifluoro-p-anisonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Trifluoromethoxy)benzonitrile
CAS:Formula:C8H4F3NOPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:187.124-(Trifluoromethoxy)benzonitrile
CAS:4-(Trifluoromethoxy)benzonitrileFormula:C8H4F3NOPurity:98%Color and Shape:Colourless to pale yellow. LiquidMolecular weight:187.118664-(Trifluoromethoxy)benzonitrile
CAS:Formula:C8H4F3NOPurity:98%Color and Shape:LiquidMolecular weight:187.1187p-(Trifluoromethoxy)benzonitrile
CAS:p-(Trifluoromethoxy)benzonitrile is an organic compound that reacts with electron-rich molecules to form a covalent bond. It has been shown to be reactive in abiotic conditions and can be used as a probe for electron transfer reactions. p-Trifluoromethoxybenzonitrile undergoes a reaction mechanism in which the carbonyl group first reacts with an electron donor, such as acetonitrile, to form an unstable intermediate. This intermediate then reacts with a second electron-rich molecule to form the product. p-Trifluoromethoxybenzonitrile also has been shown to react efficiently with benzonitrile and produce the desired product in one step.
Formula:C8H4F3NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:187.12 g/mol4-(Trifluoromethoxy)benzonitrile
CAS:Formula:C8H4F3NOPurity:98%Color and Shape:LiquidMolecular weight:187.121




