CymitQuimica logo

CAS 332187-61-8

:

tert-Butyl 6-chloro-2-oxo-1,2-dihydro-1'H-spiro[3,1-benzoxazine-4,4'-piperidine]-1'-carboxylate

Description:
Tert-Butyl 6-chloro-2-oxo-1,2-dihydro-1'H-spiro[3,1-benzoxazine-4,4'-piperidine]-1'-carboxylate, identified by its CAS number 332187-61-8, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of benzoxazine and piperidine. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups such as the carboxylate and chloro substituents. The presence of the tert-butyl group contributes to its steric bulk, which can influence its reactivity and interactions with biological targets. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the design of novel therapeutic agents. As with many synthetic organic compounds, careful consideration of its stability, reactivity, and safety profile is essential for practical applications.
Formula:C17H21ClN2O4
InChI:InChI=1/C17H21ClN2O4/c1-16(2,3)24-15(22)20-8-6-17(7-9-20)12-10-11(18)4-5-13(12)19-14(21)23-17/h4-5,10H,6-9H2,1-3H3,(H,19,21)
InChI key:ORBJFEDABMATJI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CC1)c1cc(ccc1N=C(O)O2)Cl
Found 4 products.