CymitQuimica logo

CAS 33225-51-3

:

maleic-D2 anhydride

Description:
Maleic-D2 anhydride, with the CAS number 33225-51-3, is a deuterated form of maleic anhydride, a cyclic anhydride derived from maleic acid. This compound is characterized by its molecular structure, which includes a five-membered ring containing two carbonyl groups. Maleic-D2 anhydride is typically a colorless to pale yellow solid at room temperature and is known for its reactivity, particularly in addition reactions with nucleophiles due to the presence of the anhydride functional group. The deuteration (substitution of hydrogen atoms with deuterium) can influence its physical and chemical properties, such as its isotopic labeling in research applications. It is soluble in organic solvents like acetone and ether but has limited solubility in water. Maleic-D2 anhydride is used in various applications, including polymer chemistry, where it serves as a monomer or a reactive intermediate in the synthesis of copolymers and other chemical compounds. Safety precautions should be observed when handling this substance, as it can be irritant and potentially harmful.
Formula:C4D2O3
InChI:InChI=1/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H/i1D,2D
InChI key:FPYJFEHAWHCUMM-QDNHWIQGSA-N
SMILES:C1(=C(C(=O)OC1=O)[2H])[2H]
Synonyms:
  • 3,4-Dideuteriofuran-2,5-Dione
Found 3 products.