CymitQuimica logo

CAS 3323-91-9

:

3-Pyridinecarboxylic acid, 4-hydrazinyl-

Description:
3-Pyridinecarboxylic acid, 4-hydrazinyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 3-position and a hydrazine group (-NH-NH2) at the 4-position of the pyridine ring. It is typically a white to off-white solid, soluble in polar solvents such as water and alcohols due to the presence of the hydrophilic carboxylic acid and hydrazine functionalities. The compound may exhibit acidic properties due to the carboxylic acid group, and it can participate in various chemical reactions, including condensation and coupling reactions, making it useful in synthetic organic chemistry. Additionally, the hydrazine moiety can be reactive, potentially allowing for the formation of hydrazones or other derivatives. Its applications may extend to pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific uses would depend on further research and development.
Formula:C6H7N3O2
InChI:InChI=1S/C6H7N3O2/c7-9-5-1-2-8-3-4(5)6(10)11/h1-3H,7H2,(H,8,9)(H,10,11)
InChI key:MMXWLMITXFSVRM-UHFFFAOYSA-N
SMILES:C1=CN=CC(=C1NN)C(=O)O
Synonyms:
  • 4-Hydrazinyl-3-pyridinecarboxylic acid
  • 4-Hydrazinylpyridin-3-carboxylic acid
  • 4-hydrazinylnicotinic?acid
  • 3-Pyridinecarboxylic acid, 4-hydrazinyl-
Found 3 products.