CymitQuimica logo

CAS 332359-99-6

:

8-bromoguanosine hydrate

Description:
8-Bromoguanosine hydrate is a modified nucleoside that features a bromine atom substituted at the 8-position of the guanine base. This compound is characterized by its structural components, which include a ribose sugar linked to the guanine moiety. The presence of the bromine atom can influence the compound's biochemical properties, such as its interaction with nucleic acids and potential applications in molecular biology and medicinal chemistry. As a hydrate, it contains water molecules in its crystalline form, which can affect its solubility and stability. 8-Bromoguanosine hydrate is often studied for its role in nucleic acid research, particularly in the context of studying RNA and DNA interactions, as well as its potential therapeutic applications. The compound's unique properties may also make it a candidate for further exploration in drug development, especially in targeting specific biological pathways. Overall, 8-bromoguanosine hydrate exemplifies the diverse modifications that can occur in nucleoside chemistry, leading to varied biological activities.
Formula:C10H14BrN5O6
InChI:InChI=1/C10H12BrN5O5.H2O/c11-9-13-3-6(14-10(12)15-7(3)20)16(9)8-5(19)4(18)2(1-17)21-8;/h2,4-5,8,17-19H,1H2,(H3,12,14,15,20);1H2/t2-,4-,5-,8-;/m1./s1
InChI key:GQDQASJCTAVAAG-WDIWPRJTSA-N
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2c3c(c(nc(=N)[nH]3)O)nc2Br)O1)O)O)O.O
Found 5 products.