CAS 333432-28-3
:9,9-Dimethyl-9H-Fluoren-2-yl-Boronic Acid
Description:
9,9-Dimethyl-9H-Fluoren-2-yl-Boronic Acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorenyl structure. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The presence of the dimethyl groups enhances the steric bulk around the boron atom, which can influence its reactivity and interactions with other molecules. This compound is often utilized in Suzuki-Miyaura cross-coupling reactions, a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, its unique structural features may contribute to its potential use in materials science and as a building block in the development of pharmaceuticals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C15H15BO2
InChI:InChI=1/C15H15BO2/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16(17)18)9-14(12)15/h3-9,17-18H,1-2H3
SMILES:CC1(C)c2ccccc2c2ccc(cc12)B(O)O
Synonyms:- 9,9-Dimethyl-9H-Fluoren-2-ylboronic Acid
- 9,9'-Dimethylfluorene-2-Boronic Acid
- 9,9-dimethyl-9H-fluoren-2-yl-2-boronic acid
- 9,9-Dimethyl-9H-Fluorene-2YL-Boronic Acid
- 9,9-Dimethyl-9H-Fluorene-2Y-Boronic Acid
- (9,9-dimethyl-9H-fluoren-2-yl)boronicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
9,9-Dimethylfluoren-2-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C15H15BO2Color and Shape:White to Almost white powder to crystalMolecular weight:238.09(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid
CAS:Formula:C15H15BO2Purity:98%Color and Shape:SolidMolecular weight:238.0894Ref: IN-DA0037CZ
500gTo inquire250mg20.00€1g23.00€5g31.00€10g52.00€25g81.00€50g119.00€100g158.00€250g516.00€1kg1,178.00€5kg5,656.00€9,9-Dimethyl-9H-fluorene-2-boronic acid
CAS:9,9-Dimethyl-9H-fluorene-2-boronic acidFormula:C15H15BO2Purity:>98%Color and Shape:Off-white SolidMolecular weight:238.0894(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid
CAS:(9,9-Dimethyl-9H-fluoren-2-yl)boronic acidFormula:C15H15BO2Purity:97%Molecular weight:238.099,9-Dimethyl-9H-fluoren-2-ylboronic acid
CAS:Formula:C15H15BO2Purity:96%Color and Shape:SolidMolecular weight:238.09




