CAS 333436-43-4

Benzeneacetamide, N-[4-(4-methoxyphenyl)-2-thiazolyl]-

Description:

Benzeneacetamide, N-[4-(4-methoxyphenyl)-2-thiazolyl]- is a chemical compound characterized by its structural features, which include a benzeneacetamide core and a thiazole ring substituted with a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the thiazole moiety may contribute to its pharmacological properties, as thiazoles are often found in various bioactive compounds. The methoxy group can enhance lipophilicity, potentially influencing the compound's solubility and permeability. In terms of applications, compounds like this may be explored in medicinal chemistry for their potential therapeutic effects, particularly in areas such as anti-inflammatory or antimicrobial activities. However, specific data regarding its reactivity, toxicity, and detailed biological effects would require further investigation through experimental studies and literature reviews. Overall, Benzeneacetamide, N-[4-(4-methoxyphenyl)-2-thiazolyl]- represents a class of compounds that may hold significance in drug discovery and development.

Formula: C₁₈H₁₆N₂O₂S

InChI: InChI=1S/C18H16N2O2S/c1-22-15-9-7-14(8-10-15)16-12-23-18(19-16)20-17(21)11-13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H,19,20,21)

InChI key: RZHUYMVTMZMVDE-UHFFFAOYSA-N

SMILES: COC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)CC3=CC=CC=C3

Synonyms:

• N-(4-(4-Methoxyphenyl)thiazol-2-yl)-2-phenylacetamide
• Benzeneacetamide, N-[4-(4-methoxyphenyl)-2-thiazolyl]-

N-(4-(4-Methoxyphenyl)thiazol-2-yl)-2-phenylacetamide

CAS: 333436-43-4

Formula: C₁₈H₁₆N₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 324.3968

Ref: IN-DA0F1DA4

A3AR antagonist 5

CAS: 333436-43-4

A3AR antagonist 5 (Compound 16) acts as a selective antagonist for the human adenosine A3 receptor (human adenosine A3 receptor), with an affinity expressed as a pC value of 4.542 μM.

Formula: C₁₈H₁₆N₂O₂S

Color and Shape: Solid

Molecular weight: 324.40

Ref: TM-T200493