CAS 3337-62-0
:3,5-Dibromo-4-hydroxybenzoic acid
Description:
3,5-Dibromo-4-hydroxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms and a hydroxyl group, as well as a carboxylic acid functional group. The presence of the bromine atoms at the 3 and 5 positions of the benzene ring contributes to its unique chemical properties, including increased reactivity and potential for halogenation reactions. The hydroxyl group at the 4 position enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its interactions in biological systems. This compound is often used in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. Its molecular structure allows for potential applications in dye chemistry and as a reagent in analytical chemistry. Additionally, the compound's properties may be influenced by factors such as pH and temperature, which can affect its solubility and reactivity in different environments.
Formula:C7H4Br2O3
InChI:InChI=1S/C7H4Br2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12)
InChI key:InChIKey=PHWAJJWKNLWZGJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Br)=C(O)C(Br)=C1
Synonyms:- 3,5-Dibromo p-hydroxy benzoic acid
- 3,5-Dibromo-4-Hydroxybenzoate
- Benzoic acid, 3,5-dibromo-4-hydroxy-
- Bromoxynil acid
- Bromoxynilbenzoic acid
- Bromoxynylbenzoic acid
- Nsc 21184
- 3,5-Dibromo-4-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3,5-Dibromo-4-hydroxybenzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H4Br2O3Purity:98%Color and Shape:White to pale cream, PowderMolecular weight:295.913,5-Dibromo-4-hydroxybenzoic acid
CAS:Formula:C7H4Br2O3Purity:97%Color and Shape:SolidMolecular weight:295.91293,5-Dibromo-4-hydroxybenzoic acid
CAS:3,5-Dibromo-4-hydroxybenzoic acidFormula:C7H4Br2O3Purity:98%Color and Shape: off-white to faint brown powderMolecular weight:295.91g/molBenzbromarone Impurity 5 (Dibromohydroxy Benzoic Acid)
CAS:Formula:C7H4Br2O3Color and Shape:White To Off-White SolidMolecular weight:295.913,5-Dibromo-4-hydroxybenzoic Acid
CAS:Controlled ProductFormula:C7H4Br2O3Color and Shape:NeatMolecular weight:295.913,5-Dibromo-4-hydroxybenzoic acid
CAS:3,5-Dibromo-4-hydroxybenzoic acid is a chemical that is used as a herbicide and insecticide. It inhibits the growth of plants by preventing protein synthesis in cells. 3,5-Dibromo-4-hydroxybenzoic acid has been found to be effective against bacteria such as Escherichia coli, Pseudomonas aeruginosa, and Klebsiella pneumoniae. The compound also has an inhibitory effect on the growth of industrial chemicals such as ethylene oxide and acetaldehyde. 3,5-Dibromo-4-hydroxybenzoic acid is produced from p-hydroxybenzoic acid by the action of corrin (a bacterial enzyme).Formula:C7H4Br2O3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:295.91 g/mol3,5-Dibromo-4-hydroxybenzoic acid
CAS:Formula:C7H4Br2O3Purity:97%Color and Shape:Solid, White to almost white powderMolecular weight:295.914








