CymitQuimica logo

CAS 33458-26-3

:

ethyl 6-methyl-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate

Description:
Ethyl 6-methyl-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate, with the CAS number 33458-26-3, is a heterocyclic compound characterized by its tetrahydropyrimidine core, which features a thioxo group and an ethyl ester functional group. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the phenyl group contributes to its lipophilicity, potentially influencing its pharmacokinetic properties. The thioxo group may enhance its reactivity and interaction with biological targets. Ethyl esters are generally known for their volatility and solubility in organic solvents, which can facilitate various synthetic applications. The compound's structure suggests potential applications in drug development, particularly in the synthesis of novel pharmaceuticals. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines. Overall, this compound represents a unique scaffold for further exploration in chemical and pharmaceutical research.
Formula:C14H16N2O2S
InChI:InChI=1/C14H16N2O2S/c1-3-18-13(17)11-9(2)15-14(19)16-12(11)10-7-5-4-6-8-10/h4-8,12H,3H2,1-2H3,(H2,15,16,19)
InChI key:QMFBVGUFEGVPNG-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(C)N=C(NC1c1ccccc1)S
Synonyms:
  • ethyl (4S)-6-methyl-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
  • ethyl (4R)-6-methyl-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Found 4 products.