CAS 33468-32-5
:2-Methyl-L-tryptophan
Description:
2-Methyl-L-tryptophan is an amino acid derivative and a structural analog of the essential amino acid L-tryptophan. It is characterized by the presence of a methyl group at the second carbon of the indole ring, which alters its biochemical properties compared to L-tryptophan. This compound is known for its role in various biological processes, including its potential influence on serotonin metabolism and immune response modulation. It is often studied in the context of cancer immunotherapy, as it can affect T-cell function and has been implicated in tumor-induced immune tolerance. 2-Methyl-L-tryptophan is typically a white to off-white crystalline powder, soluble in water and organic solvents, and is stable under standard laboratory conditions. Its molecular structure includes an indole ring, an amino group, and a carboxylic acid group, which are characteristic of amino acids. As a research chemical, it is used in various biochemical assays and studies to explore its effects on cellular processes and potential therapeutic applications.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-7-9(6-10(13)12(15)16)8-4-2-3-5-11(8)14-7/h2-5,10,14H,6,13H2,1H3,(H,15,16)/t10-/m0/s1
InChI key:InChIKey=BXJSOEWOQDVGJW-JTQLQIEISA-N
SMILES:C([C@@H](C(O)=O)N)C=1C=2C(NC1C)=CC=CC2
Synonyms:- (2S)-2-Amino-3-(2-methyl-1H-indol-3-yl)propanoic acid
- 2-Methyl-<span class="text-smallcaps">L</span>-tryptophan
- <span class="text-smallcaps">L</span>-Tryptophan, 2-methyl-
- Tryptophan, 2-Methyl-
- Tryptophan, 2-methyl-, <span class="text-smallcaps">L</span>-
- 2-Methyltryptophan
- 2-Methyl-L-tryptophan
- L-Tryptophan, 2-methyl-
- Tryptophan, 2-methyl-, L-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(S)-2-amino-3-(2-methyl-1H-indol-3-yl)propanoic acid
CAS:Purity:98%Color and Shape:SolidMolecular weight:218.2559967(S)-2-Amino-3-(2-methyl-1H-indol-3-yl)propanoic acid
CAS:(S)-2-Amino-3-(2-methyl-1H-indol-3-yl)propanoic acidFormula:C12H14N2O2Purity:98%Molecular weight:218.26H-Trp(2-Br)-OH
CAS:(S)-2-Amino-3-(2-methyl-1H-indol-3-yl)propanoic acidFormula:C12H14N2O2Purity:98%Molecular weight:218.252-Methyl-L-tryptophan
CAS:2-Methyl-L-tryptophan is a natural amino acid that is an intermediate in the biosynthesis of tryptophan. It has been used to study protein synthesis and as a potential antibiotic. 2-Methyl-L-tryptophan has been shown to be stereoselective with respect to the enzyme catalysis of its hydroxylation. This active form is converted into the antibiotic thiostrepton by enzymatic reactions.Formula:C12H14N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:218.25 g/mol
