CAS 335-76-2: nonadecafluorodecanoic acid
Description:Nonadecafluorodecanoic acid, with the CAS number 335-76-2, is a perfluorinated carboxylic acid characterized by a long carbon chain fully substituted with fluorine atoms, specifically containing 19 fluorine atoms and a decanoic acid backbone. This compound is part of a larger class of perfluoroalkyl substances (PFAS), known for their unique properties, including high thermal stability, resistance to chemical degradation, and low surface tension. Nonadecafluorodecanoic acid is typically a solid at room temperature and exhibits hydrophobic and lipophobic characteristics, making it useful in various industrial applications, including surfactants and coatings. However, like many PFAS, it raises environmental and health concerns due to its persistence in the environment and potential bioaccumulation. Its production and use are subject to increasing regulatory scrutiny, reflecting growing awareness of the ecological and health impacts associated with perfluorinated compounds. Overall, nonadecafluorodecanoic acid exemplifies the dual nature of chemical substances that can offer utility while posing significant environmental challenges.
Formula:C10HF19O2
InChI:InChI=1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31)
InChI key:InChIKey=PCIUEQPBYFRTEM-UHFFFAOYSA-N
SMILES:O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluorodecanoic acid
- 2H,2H-Perfluorodecanoic acid
- Decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-
- Decanoic acid, nonadecafluoro-
- Nonadecafluoro-n-decanoic acid
- Nonadecafluorodecanoic acid~Perfluorocapric acid
- Perfluoro-1-nonanecarboxylic acid
- Perfluoro-n-decanoic acid
- Perfluorocapric acid
- Perfluorodecanoic acid
- See more synonyms
- Nonadecafluorodecanoic acid
