CAS 3351-86-8: Fucoxanthin
Description:Fucoxanthin is a carotenoid pigment predominantly found in brown algae and diatoms, contributing to their characteristic color. It is a xanthophyll, which means it contains oxygen in its structure, distinguishing it from other carotenoids that are purely hydrocarbon-based. Fucoxanthin is known for its antioxidant properties, which help protect cells from oxidative stress. It has garnered interest in nutritional and pharmaceutical research due to potential health benefits, including anti-inflammatory, anti-cancer, and anti-obesity effects. The compound is soluble in organic solvents but has limited solubility in water, which influences its bioavailability. Fucoxanthin's structure features a unique allenic bond and a furan ring, contributing to its stability and functionality. Additionally, it plays a role in photosynthesis by capturing light energy, making it essential for the survival of the organisms that produce it. Overall, fucoxanthin is a significant compound in both ecological and health-related contexts, with ongoing studies exploring its various applications.
Formula:C42H58O6
InChI:InChI=1S/C42H58O6/c1-29(18-14-19-31(3)22-23-37-38(6,7)26-35(47-33(5)43)27-40(37,10)46)16-12-13-17-30(2)20-15-21-32(4)36(45)28-42-39(8,9)24-34(44)25-41(42,11)48-42/h12-22,34-35,44,46H,24-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23?,34-,35-,40+,41+,42-/m0/s1
InChI key:InChIKey=SJWWTRQNNRNTPU-ABBNZJFMSA-N
SMILES:O=C(OC1CC(O)(C(=C=CC(=CC=CC(=CC=CC=C(C=CC=C(C(=O)CC23OC3(C)CC(O)CC2(C)C)C)C)C)C)C(C)(C)C1)C)C
- Synonyms:
- (3S,3′S,5R,5′R,6S,6′R)-3′-(Acetyloxy)-6′,7′-didehydro-5,6-epoxy-5,5′,6,6′,7,8-hexahydro-3,5′-dihydroxy-8-oxo-β,β-carotene
- 2,4-Dihydroxy-3,3-Dimethylbutanoic Acid
- 3'-(Acetyloxy)-6',7'-didehydro-5,6-epoxy-5,5',6,6',7,8-hexahydro-3,5'-dihydroxy-8-oxo-beta,beta-carotene
- 3,5'-Dihydroxy-8-Oxo-6',7'-Didehydro-5,5',6,6',7,8-Hexahydro-5,6-Epoxy-Beta,Beta-Caroten-3'-Yl Acetate
- Fucoxanthin, all-trans-
- Infinity 50
- Sebatrol
- all-E-(3S,5R,6S,3′S,5′R,6′R)-Fucoxanthin
- all-trans-Fucoxanthin
- α-Carotene, 6′,7′-didehydro-5,6-epoxy-4′,5,5′,6,7,8-hexahydro-3,3′,5′-trihydroxy-8-oxo-, 3′-acetate
- See more synonyms
- α-Carotene, 6′,7′-didehydro-5,6-epoxy-4′,5,5′,6,7,8-hexahydro-3,3′,5′-trihydroxy-8-oxo-, 3′-acetate, all-trans-
- β,β-Carotene, 3′-(acetyloxy)-6′,7′-didehydro-5,6-epoxy-5,5′,6,6′,7,8-hexahydro-3,5′-dihydroxy-8-oxo-, (3S,3′S,5R,5′R,6S,6′R)-
- Fucoxanthin