CAS 3351-86-8
:Fucoxanthin
Description:
Fucoxanthin is a carotenoid pigment predominantly found in brown algae and diatoms, contributing to their characteristic color. It is a xanthophyll, which means it contains oxygen in its structure, distinguishing it from other carotenoids that are purely hydrocarbon-based. Fucoxanthin is known for its antioxidant properties, which help protect cells from oxidative stress. It has garnered interest in nutritional and pharmaceutical research due to potential health benefits, including anti-inflammatory, anti-cancer, and anti-obesity effects. The compound is soluble in organic solvents but has limited solubility in water, which influences its bioavailability. Fucoxanthin's structure features a unique allenic bond and a furan ring, contributing to its stability and functionality. Additionally, it plays a role in photosynthesis by capturing light energy, making it essential for the survival of the organisms that produce it. Overall, fucoxanthin is a significant compound in both ecological and health-related contexts, with ongoing studies exploring its various applications.
Formula:C42H58O6
InChI:InChI=1S/C42H58O6/c1-29(18-14-19-31(3)22-23-37-38(6,7)26-35(47-33(5)43)27-40(37,10)46)16-12-13-17-30(2)20-15-21-32(4)36(45)28-42-39(8,9)24-34(44)25-41(42,11)48-42/h12-22,34-35,44,46H,24-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23?,34-,35-,40+,41+,42-/m0/s1
InChI key:InChIKey=SJWWTRQNNRNTPU-ABBNZJFMSA-N
SMILES:C(C(/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=[C@@]=C1[C@](C)(C)C[C@H](OC(C)=O)C[C@@]1(C)O)\C)\C)/C)/C)=O)[C@]23[C@](C)(O2)C[C@@H](O)CC3(C)C
Synonyms:- (3S,3′S,5R,5′R,6S,6′R)-3′-(Acetyloxy)-6′,7′-didehydro-5,6-epoxy-5,5′,6,6′,7,8-hexahydro-3,5′-dihydroxy-8-oxo-β,β-carotene
- 2,4-Dihydroxy-3,3-Dimethylbutanoic Acid
- 3'-(Acetyloxy)-6',7'-didehydro-5,6-epoxy-5,5',6,6',7,8-hexahydro-3,5'-dihydroxy-8-oxo-beta,beta-carotene
- 3,5'-Dihydroxy-8-Oxo-6',7'-Didehydro-5,5',6,6',7,8-Hexahydro-5,6-Epoxy-Beta,Beta-Caroten-3'-Yl Acetate
- Fucoxanthin, all-trans-
- Infinity 50
- Sebatrol
- all-E-(3S,5R,6S,3′S,5′R,6′R)-Fucoxanthin
- all-trans-Fucoxanthin
- α-Carotene, 6′,7′-didehydro-5,6-epoxy-4′,5,5′,6,7,8-hexahydro-3,3′,5′-trihydroxy-8-oxo-, 3′-acetate
- α-Carotene, 6′,7′-didehydro-5,6-epoxy-4′,5,5′,6,7,8-hexahydro-3,3′,5′-trihydroxy-8-oxo-, 3′-acetate, all-trans-
- β,β-Carotene, 3′-(acetyloxy)-6′,7′-didehydro-5,6-epoxy-5,5′,6,6′,7,8-hexahydro-3,5′-dihydroxy-8-oxo-, (3S,3′S,5R,5′R,6S,6′R)-
- Fucoxanthin
- beta,beta-carotene,3’-(acetyloxy)-6’,7’-didehydro-5,6-epoxy-5,5’,6,6’,7,8-hexa
- (3S,3'S,5R,5'R,6S,6'R)-6',7'-Didehydro-5,6-epoxy-4',5',6,7-tetrahydro-3,3',5'-trihydroxy-,-caroten-8(5H)-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Fucoxanthin
CAS:Formula:C42H58O6Purity:≥ 98.0%Color and Shape:Red to very dark powderMolecular weight:658.91Fucoxanthin
CAS:Fucoxanthin is a brown seaweed pigment that is found in most brown seaweeds, as well as a few other marine sources. It is a xanthophyll, which is a molecule structurally similar to beta-carotene and vitamin A; yet fucoxanthin does not possess vitamin-like activity in the body.Formula:C42H58O6Purity:10%, 50%, 90%, 95%, 98% by HPLC-DADIdentification MethodMolecular weight:658.92Fucoxanthin
CAS:Fucoxanthin (all-trans-Fucoxanthin) is a carotenoid that occurs naturally in certain algae.Formula:C42H58O6Purity:99.0300% - 99.39%Color and Shape:Crystalline PowderMolecular weight:658.91Ref: TM-T7600
1mg34.00€2mg46.00€5mg70.00€1mL*10mM (DMSO)92.00€10mg101.00€25mg230.00€50mg409.00€100mg605.00€500mg1,288.00€Fucoxanthine
CAS:Fucoxanthine is a marine carotenoid, which is predominantly found in various species of brown seaweed, such as Undaria pinnatifida and Laminaria japonica. Its molecular structure includes an allenic bond, which distinguishes it from other carotenoids and contributes to its unique mode of action. Fucoxanthine exerts its effects primarily through antioxidant activity, where it neutralizes free radicals, thus reducing oxidative stress. Additionally, it modulates metabolic processes by influencing genes involved in lipid metabolism and adipose tissue differentiation.Formula:C42H58O6Purity:Min. 95%Color and Shape:Red PowderMolecular weight:658.91 g/molFucoxanthine - 10%
CAS:Fucoxanthine - 10% is a carotenoid compound, which is extracted from brown seaweeds such as Undaria pinnatifida and Laminaria japonica. This compound is known for its unique structure and biochemistry, which allows it to influence metabolic processes within the body. Fucoxanthine primarily functions by increasing the expression of uncoupling protein 1 (UCP1) in white adipose tissue, which in turn enhances lipid metabolism and thermogenesis. This action leads to a potential increase in energy expenditure and fat oxidation.Formula:C42H58O6Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:658.91 g/molFucoxanthine - 50%
CAS:Fucoxanthine - 50% is a carotenoid compound typically derived from brown seaweeds, such as Undaria pinnatifida and Laminaria japonica. This naturally occurring xanthophyll is recognized for its role in promoting metabolic health due to its unique mode of action. Fucoxanthine enhances the expression of uncoupling protein 1 (UCP1) in white adipose tissue, leading to increased thermogenesis and fat oxidation. This process is largely mediated through the activation of antioxidant pathways and modulation of metabolic regulators.Formula:C42H58O6Purity:Min. 95%Color and Shape:PowderMolecular weight:658.91 g/mol






