CAS 335161-14-3
:[1-(4-Hydroxybutyl)-1H-indol-3-yl]-1-naphthalenylmethanone
Description:
[1-(4-Hydroxybutyl)-1H-indol-3-yl]-1-naphthalenylmethanone, with the CAS number 335161-14-3, is a synthetic compound that belongs to the class of indole derivatives. This substance features a complex molecular structure characterized by the presence of an indole moiety, which is a bicyclic structure composed of a benzene ring fused to a pyrrole ring, and a naphthalenylmethanone group. The hydroxybutyl substituent enhances its solubility and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological properties, including anti-inflammatory, analgesic, or anticancer activities. The presence of both hydrophilic (hydroxy group) and hydrophobic (naphthalene) components suggests that it may interact with biological membranes and proteins in unique ways. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by its functional groups, making it a subject of interest in medicinal chemistry and drug development. Further research is necessary to fully elucidate its properties and potential applications.
Formula:C23H21NO2
InChI:InChI=1S/C23H21NO2/c25-15-6-5-14-24-16-21(19-11-3-4-13-22(19)24)23(26)20-12-7-9-17-8-1-2-10-18(17)20/h1-4,7-13,16,25H,5-6,14-15H2
InChI key:InChIKey=FIBVDFAPDNJBNI-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=2C(N(CCCCO)C1)=CC=CC2)C=3C4=C(C=CC3)C=CC=C4
Synonyms:- Methanone, [1-(4-hydroxybutyl)-1H-indol-3-yl]-1-naphthalenyl-
- JWH 073 N-(4-hydroxybutyl) metabolite
- [1-(4-Hydroxybutyl)-1H-indol-3-yl]-1-naphthalenylmethanone
- JWH 073 N-(4-hydroxybutyl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
JWH-073 N-(4-hydroxybutyl) metabolite, 0.1mg/ml in Methanol
CAS:Controlled ProductColor and Shape:ColourlessJWH-073 N-(4-hydroxybutyl) metabolite, 1mg/ml in Methanol
CAS:Controlled ProductColor and Shape:ColourlessJWH-073 4-Hydroxybutyl
CAS:Controlled ProductFormula:C23H21NO2Color and Shape:NeatMolecular weight:343.42

