CymitQuimica logo

CAS 33530-51-7

:

Phosphetane, 1,2,2,3,4,4-hexamethyl-, 1-oxide, cis-

Description:
Phosphetane, 1,2,2,3,4,4-hexamethyl-, 1-oxide, cis- is a chemical compound characterized by its unique structure, which includes a phosphorous atom in a five-membered ring, specifically a phosphetane framework. The presence of six methyl groups contributes to its steric bulk and influences its reactivity and stability. The "1-oxide" designation indicates that there is an oxygen atom bonded to the phosphorus, which can affect the compound's electronic properties and potential reactivity. The "cis-" configuration suggests that certain substituents are oriented on the same side of the ring, which can impact the compound's physical properties, such as boiling point and solubility. Phosphetanes are of interest in organic and inorganic chemistry due to their potential applications in synthesis and as intermediates in various chemical reactions. However, detailed information regarding its specific reactivity, stability, and applications may require further investigation in specialized literature or databases.
Formula:C9H19OP
InChI:InChI=1S/C9H19OP/c1-7-8(2,3)11(6,10)9(7,4)5/h7H,1-6H3
InChI key:VZDDSVNSOUGNBM-UHFFFAOYSA-N
SMILES:CC1C(P(=O)(C1(C)C)C)(C)C
Synonyms:
  • Phosphetane, 1,2,2,3,4,4-hexamethyl-, 1-oxide, cis-
  • anti-1,2,2,3,4,4-Hexamethylphosphetane 1-Oxide
  • cis-1,2,2,3,4,4-hexamethyl-1phosphetane 1-oxide
  • cis-1,2,2,3,4,4-Hexamethylphosphetane 1-Oxide
Found 3 products.