CymitQuimica logo

CAS 33729-92-9

:

tert-Butyldiphenylsilane

Description:
Tert-Butyldiphenylsilane, with the CAS number 33729-92-9, is an organosilicon compound characterized by its structure, which features a silicon atom bonded to two phenyl groups and a tert-butyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its stability and low reactivity, making it useful in various chemical applications, including as a protecting group in organic synthesis. Tert-Butyldiphenylsilane is also utilized in the preparation of silane-based materials and as a reagent in the synthesis of other organosilicon compounds. Its hydrophobic nature and ability to form stable siloxane bonds contribute to its utility in materials science and polymer chemistry. Additionally, it is important to handle this compound with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory settings.
Formula:C16H20Si
InChI:InChI=1S/C16H20Si/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,17H,1-3H3
InChI key:VTORJPDWMOIOIQ-UHFFFAOYSA-N
SMILES:CC(C)(C)[SiH](C1=CC=CC=C1)C2=CC=CC=C2
Found 5 products.