CymitQuimica logo

CAS 337508-68-6

:

6-morpholin-4-yl-pyridine-3-sulfonyl chloride

Description:
6-Morpholin-4-yl-pyridine-3-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a pyridine ring substituted with a morpholine group and a sulfonyl chloride moiety, making it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of the morpholine ring contributes to its solubility and potential biological activity. As a sulfonyl chloride, it can participate in nucleophilic substitution reactions, allowing for the introduction of various nucleophiles, such as amines or alcohols, to form sulfonamides or sulfonate esters. This compound is typically handled with care due to its reactive nature, particularly in the presence of moisture, which can lead to hydrolysis. Its applications may extend to medicinal chemistry, where it can serve as a building block for the development of biologically active molecules. Proper safety measures should be observed when working with this compound due to its potential irritant properties.
Formula:C9H11ClN2O3S
InChI:InChI=1/C9H11ClN2O3S/c10-16(13,14)8-1-2-9(11-7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2
InChI key:FZQDEGBLWSULKG-UHFFFAOYSA-N
SMILES:c1cc(ncc1S(=O)(=O)Cl)N1CCOCC1
Found 3 products.