
CAS 339370-40-0
:5-Bromo-2-fluorobenzenesulphonyl chloride
Description:
5-Bromo-2-fluorobenzenesulphonyl chloride is an organic compound characterized by the presence of a sulphonyl chloride functional group attached to a benzene ring that is substituted with both bromine and fluorine atoms. This compound typically appears as a colorless to pale yellow solid and is known for its reactivity, particularly due to the sulphonyl chloride group, which can participate in nucleophilic substitution reactions. The presence of the bromine and fluorine substituents can influence the compound's electronic properties, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. It is important to handle this compound with care, as sulphonyl chlorides can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Additionally, its unique structure allows for potential applications in various chemical transformations, including the formation of sulphonamides and other derivatives. Proper safety measures should be observed when working with this compound due to its reactive nature.
Formula:C6H3BrClFO2S
InChI:InChI=1S/C6H3BrClFO2S/c7-4-1-2-5(9)6(3-4)12(8,10)11/h1-3H
InChI key:LLDLTDWAHZBZIQ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Br)S(=O)(=O)Cl)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-fluorobenzenesulphonyl chloride
CAS:5-Bromo-2-fluorobenzenesulphonyl chlorideFormula:C6H3BrClFO2SPurity:98%Color and Shape:SolidMolecular weight:273.50722Benzenesulfonyl chloride, 5-bromo-2-fluoro-
CAS:Formula:C6H3BrClFO2SPurity:95%Color and Shape:SolidMolecular weight:273.50725-Bromo-2-fluorobenzene-1-sulfonyl chloride
CAS:5-Bromo-2-fluorobenzene-1-sulfonyl chlorideFormula:C6H3BrClFO2SPurity:95%Molecular weight:273.515-Bromo-2-fluorobenzenesulfonyl chloride
CAS:Formula:C6H3BrClFO2SPurity:95%Color and Shape:SolidMolecular weight:273.55-Bromo-2-fluoro-benzenesulfonyl chloride
CAS:5-Bromo-2-fluoro-benzenesulfonyl chloride (5BFCl) is a chemical reagent used in organic synthesis. It is a chlorinating agent that gives a high yield of 5-bromo-2-fluoroaniline and chloride. 5BFCl reacts with electron rich aromatic compounds, such as anilines, to form sulfones. The reaction is highly selective for electron rich aromatic compounds and can be used to produce target products from the desired reactant.Formula:C6H3BrClFO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:273.51 g/mol




