CAS 3395-35-5
:3,4-Dehydroproline
Description:
3,4-Dehydroproline is a non-proteinogenic amino acid characterized by its unique structure, which features a double bond between the carbon atoms at the 3rd and 4th positions of the proline ring. This structural modification imparts distinct properties compared to standard proline, influencing its reactivity and interactions in biological systems. The compound is typically found in certain natural products and can be synthesized through various chemical methods. It exhibits a relatively high melting point and is soluble in polar solvents, which is common for amino acids. 3,4-Dehydroproline plays a role in peptide synthesis and can affect the conformation of peptides due to its rigid structure. Additionally, it has been studied for its potential biological activities, including effects on protein folding and stability. Its CAS number, 3395-35-5, is used for identification in chemical databases and regulatory contexts. Overall, 3,4-Dehydroproline is of interest in both synthetic chemistry and biochemistry due to its unique properties and potential applications.
Formula:C5H7NO2
InChI:InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h1-2,4,6H,3H2,(H,7,8)
InChI key:InChIKey=OMGHIGVFLOPEHJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C=CCN1
Synonyms:- 1H-Pyrrole-2-carboxylic acid, 2,5-dihydro-
- 2,5-dihydro-1H-pyrrole-2-carboxylic acid
- 3,4-Dedihydroproline
- 3,4-Dehydro-<span class="text-smallcaps">D</smallcap>,<smallcap>L</span>-proline
- 3,4-Dehydro-<span class="text-smallcaps">DL</span>-proline
- 3,4-Dehydroproline
- 3,4-Didehydroproline
- 3,4-dehydro-D-L-proline
- 3-Pyrroline-2-carboxylic acid
- 3-Pyrroline-2-carboxylic acid, <span class="text-smallcaps">DL</span>-
- 4-Pyrroline-2-carboxylic acid, <span class="text-smallcaps">DL</span>-
- <span class="text-smallcaps">DL</span>-3,4-Dehydroproline
- H-3,4-Dehydro-DL-Pro-OH
- NSC 49883
- Proline, 3,4-didehydro-
- 3,4-Dehydro-DL-proline
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5-dihydro-1H-pyrrole-2-carboxylic acid
CAS:Formula:C5H7NO2Purity:97%Color and Shape:SolidMolecular weight:113.11462,5-Dihydro-1H-pyrrole-2-carboxylic acid
CAS:2,5-Dihydro-1H-pyrrole-2-carboxylic acidFormula:C5H7NO2Purity:97%Color and Shape:SolidMolecular weight:113.114573,4-Dehydro-DL-proline
CAS:3,4-Dehydro-DL-proline is a monoclonal antibody that is known for its ability to bind to the amino acid proline. It has been shown to be effective in the treatment of resistant mutants in plant science, tissue culture, and biological studies. 3,4-Dehydro-DL-proline binds to collagen, amide and proline analogs and hydrogen bonds with them. 3,4-Dehydro-DL-proline also has conformational properties that are important for its function as an anti-inflammatory agent.
Formula:C5H7NO2Purity:Min. 95%Molecular weight:113.11 g/mol




