CAS 33983-39-0
:(6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol
Description:
The chemical substance known as (6aS,11aS)-9-methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol, with the CAS number 33983-39-0, is a complex organic compound characterized by its unique bicyclic structure that combines elements of benzofuran and chromene. This compound features a methoxy group, which contributes to its solubility and reactivity. The stereochemistry indicated by the (6aS,11aS) configuration suggests specific spatial arrangements of its atoms, which can influence its biological activity and interaction with other molecules. Typically, such compounds may exhibit various pharmacological properties, including potential antioxidant or anti-inflammatory effects, although specific biological activities would require empirical investigation. The presence of hydroxyl and methoxy functional groups often enhances the compound's ability to participate in hydrogen bonding and may affect its lipophilicity. Overall, this substance represents a class of compounds that may have applications in medicinal chemistry and natural product synthesis, warranting further research into its properties and potential uses.
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-18-10-3-5-11-13-8-19-14-6-9(17)2-4-12(14)16(13)20-15(11)7-10/h2-7,13,16-17H,8H2,1H3/t13-,16-/m1/s1
SMILES:COc1ccc2[C@H]3COc4cc(ccc4[C@H]3Oc2c1)O
Synonyms:- 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, cis-
- Medicarpin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(+/-)-Medicarpin
CAS:(+/-)-Medicarpin is a natural isoflavonoid compound, which is derived from various leguminous plants, such as Medicago species. It functions as a phytoalexin, a type of antimicrobial and often antioxidative substance synthesized by plants as part of their defense mechanism against pathogens. The mode of action of (+/-)-Medicarpin involves disruption of the cellular processes of fungi, particularly by inhibiting the biosynthesis of ergosterol, a critical component of fungal cell membranes. This inhibition can lead to increased membrane permeability and subsequent cell death.
Formula:C16H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:270.28 g/mol(+)-Medicarpin
CAS:(+)-Medicarpin, an isoflavonoid from plants like Sophora japonica, inhibits osteoclastogenesis and boosts bone mass via ERβ.Formula:C16H14O4Purity:99.86% - 99.95%Color and Shape:SolidMolecular weight:270.28Ref: TM-T13768
1mg131.00€5mg301.00€1mL*10mM (DMSO)324.00€10mg411.00€25mg605.00€50mg815.00€100mg1,063.00€200mg1,423.00€



