CAS 3400-55-3
:2-Bromo-1,1-diethoxypropane
Description:
2-Bromo-1,1-diethoxypropane, with the CAS number 3400-55-3, is an organic compound characterized by the presence of a bromine atom and two ethoxy groups attached to a propane backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The ethoxy groups contribute to its solubility in organic solvents and influence its boiling and melting points. It is often used in organic synthesis as an intermediate or reagent, particularly in the formation of other organic compounds. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled. Proper storage in a cool, dry place away from incompatible substances is essential to maintain its stability and prevent hazardous reactions.
Formula:C7H15BrO2
InChI:InChI=1S/C7H15BrO2/c1-4-9-7(6(3)8)10-5-2/h6-7H,4-5H2,1-3H3
InChI key:InChIKey=AHIUAFXWZKCJLR-UHFFFAOYSA-N
SMILES:C(OCC)(OCC)C(Br)C
Synonyms:- 1,1-Diethoxy-2-bromopropane
- 2-Bromopriopionaldehyde Diethyl Acetal
- 2-Bromopropionaldehyde diethyl acetal
- Propane, 2-bromo-1,1-diethoxy-
- Propionaldehyde, 2-bromo-, diethyl acetal
- β-Bromopropionaldehyde diethyl acetal
- 2-Bromo-1,1-diethoxypropane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-1,1-Diethoxypropane
CAS:2-Bromo-1,1-DiethoxypropaneFormula:C7H15BrO2Purity:>98%Molecular weight:211.12-Bromo-1,1-diethoxypropane
CAS:Formula:C7H15BrO2Purity:95%Color and Shape:LiquidMolecular weight:211.09682-Bromopropionaldehyde diethyl acetal
CAS:2-Bromopropionaldehyde diethyl acetalFormula:C7H15BrO2Purity:98%Molecular weight:211.12-Bromopropionaldehyde diethyl acetal
CAS:2-Bromopropionaldehyde diethyl acetalFormula:C7H15BrO2Purity:95%Molecular weight:211.12-Bromopriopionaldehydediethylacetal
CAS:Formula:C7H15BrO2Purity:95%Color and Shape:LiquidMolecular weight:211.0992-Bromopropionaldehyde Diethyl Acetal
CAS:2-Bromopropionaldehyde diethyl acetal is an organic compound that is used as a reactant in the preparation of other compounds. It can be prepared by the reaction of 3-bromo-1-propanol with magnesium in ether. The reaction is catalyzed by pyridinium chlorochromate, which facilitates the ring-opening reaction. The product can also be used to introduce alkyl groups onto aromatic rings, such as benzene and naphthalene. 2-Bromopropionaldehyde diethyl acetal has a high redox potential, making it reactive and nucleophilic.Formula:C7H15BrO2Purity:Min. 95%Molecular weight:211.1 g/mol




