CymitQuimica logo

CAS 34003-67-3

:

3-(Dipropylamino)-1-propanol

Description:
3-(Dipropylamino)-1-propanol, with the CAS number 34003-67-3, is an organic compound characterized by the presence of a propanol backbone substituted with a dipropylamino group. This compound typically appears as a colorless to pale yellow liquid and is soluble in water due to the hydroxyl (-OH) group, which enhances its polarity. The dipropylamino moiety contributes to its basicity, making it a potential candidate for various applications in organic synthesis and as a reagent in chemical reactions. Its structure allows for hydrogen bonding, which can influence its physical properties, such as boiling point and viscosity. Additionally, 3-(Dipropylamino)-1-propanol may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound's unique structure and properties make it a valuable subject of study in both academic and industrial chemistry contexts.
Formula:C9H21NO
InChI:InChI=1S/C9H21NO/c1-3-6-10(7-4-2)8-5-9-11/h11H,3-9H2,1-2H3
InChI key:InChIKey=HVQPWDRWEZEOCN-UHFFFAOYSA-N
SMILES:N(CCCO)(CCC)CCC
Synonyms:
  • 1-Propanol, 3-(dipropylamino)-
  • 3-(Dipropylamino)-1-propanol
  • 3-(Dipropylamino)propanol
  • 3-Di-n-propylamino-1-propanol
  • gamma-Di-n-propylaminopropanol
Found 1 products.