CymitQuimica logo

CAS 340162-93-8

:

Cytidine, N-benzoyl-2'-O-(2-methoxyethyl)-5-methyl-

Description:
Cytidine, N-benzoyl-2'-O-(2-methoxyethyl)-5-methyl- is a modified nucleoside that features a cytidine base with specific chemical modifications. The presence of a benzoyl group at the nitrogen position enhances its stability and solubility, while the 2'-O-(2-methoxyethyl) modification contributes to its resistance to nucleases, making it potentially useful in therapeutic applications. The 5-methyl substitution on the cytosine base can influence its biological activity and interaction with nucleic acids. This compound is typically characterized by its molecular structure, which includes a pyrimidine ring, a ribose sugar, and the aforementioned functional groups. It may exhibit properties such as increased lipophilicity due to the benzoyl and methoxyethyl groups, which can affect its pharmacokinetics. Additionally, its synthesis and characterization often involve techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. Overall, this compound represents a class of nucleoside analogs that are of interest in medicinal chemistry and biochemistry for their potential roles in drug development and molecular biology research.
Formula:C20H25N3O7
InChI:InChI=1S/C20H25N3O7/c1-12-10-23(19-16(29-9-8-28-2)15(25)14(11-24)30-19)20(27)22-17(12)21-18(26)13-6-4-3-5-7-13/h3-7,10,14-16,19,24-25H,8-9,11H2,1-2H3,(H,21,22,26,27)/t14-,15-,16-,19-/m1/s1
InChI key:LGGHYGUGIGYDFX-YKTARERQSA-N
SMILES:CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)OCCOC
Found 3 products.