CymitQuimica logo

CAS 3404-78-2

:

2,5-dimethylhex-2-ene

Description:
2,5-Dimethylhex-2-ene is an organic compound classified as an alkene due to the presence of a carbon-carbon double bond in its structure. It features a six-carbon chain with two methyl groups attached to the second and fifth carbon atoms, contributing to its branched nature. This compound is typically a colorless liquid at room temperature and possesses a characteristic odor. Its molecular formula is C8H16, indicating it is a saturated hydrocarbon with the potential for various chemical reactions typical of alkenes, such as addition reactions. The presence of the double bond makes it more reactive than alkanes, allowing it to participate in polymerization and other reactions. 2,5-Dimethylhex-2-ene is used in organic synthesis and may serve as an intermediate in the production of various chemicals. Safety data indicates that, like many alkenes, it should be handled with care due to potential flammability and health hazards associated with inhalation or skin contact.
Formula:C8H16
InChI:InChI=1/C8H16/c1-7(2)5-6-8(3)4/h5,8H,6H2,1-4H3
InChI key:VFZIUYUUQFYZBR-UHFFFAOYSA-N
SMILES:CC(=CCC(C)C)C
Synonyms:
  • Dimethylhexene
  • 2,5-Dimethyl-2-hexene
Found 4 products.