CAS 340825-13-0
:6-iodotetralin-1-one
Description:
6-Iodotetralin-1-one is an organic compound characterized by its structure, which includes a tetralin ring system substituted with an iodine atom and a ketone functional group. The presence of the iodine atom typically imparts unique reactivity and properties, such as increased electrophilicity, which can be exploited in various chemical reactions. The ketone group contributes to the compound's polar character, influencing its solubility and interaction with other molecules. This compound may be of interest in medicinal chemistry and organic synthesis due to its potential as a building block for more complex molecules. Additionally, the presence of the iodine atom can enhance biological activity or facilitate radiolabeling in imaging studies. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact should be taken into account during handling and disposal. Overall, 6-iodotetralin-1-one represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C10H9IO
InChI:InChI=1/C10H9IO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6H,1-3H2
SMILES:C1Cc2cc(ccc2C(=O)C1)I
Synonyms:- 6-iodo-3,4-dihydro-2H-naphthalen-1-one
- 6-Iodo-1-tetralone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Iodo-3,4-dihydronaphthalen-1(2H)-one
CAS:6-Iodo-3,4-dihydronaphthalen-1(2H)-oneFormula:C10H9IOPurity:97%Color and Shape:SolidMolecular weight:272.082336-Iodo-3,4-dihydronaphthalen-1(2H)-one
CAS:6-Iodo-3,4-dihydronaphthalen-1(2H)-oneFormula:C10H9IOPurity:98%Molecular weight:272.086-Iodo-3,4-dihydronaphthalen-1(2H)-one
CAS:6-Iodo-3,4-dihydronaphthalen-1(2H)-one is an agonist of the 5-HT6 receptor. It binds to the receptor with high affinity and functions as an antagonist of the 5-HT6 receptor. 6-Iodo-3,4-dihydronaphthalen-1(2H)-one has been shown to inhibit phosphatases and acetylcholinesterase activity in vitro. 6-Iodo-3,4-dihydronaphthalen-1(2H)-one also antagonizes the effects of pentyl on cAMP levels and promotes conformational changes in regulatory regions of 5ht6 receptor mRNA that leads to increased production of the mRNA.Formula:C10H9IOPurity:Min. 95%Molecular weight:272.08 g/mol




