CymitQuimica logo

CAS 34122-28-6

:

4-(3-phenylpropyl)pyridine N-oxide

Description:
4-(3-Phenylpropyl)pyridine N-oxide, with the CAS number 34122-28-6, is a chemical compound characterized by its pyridine ring substituted with a 3-phenylpropyl group and an N-oxide functional group. This compound typically exhibits properties associated with both pyridine derivatives and N-oxides, such as moderate polarity and potential solubility in polar organic solvents. The presence of the phenylpropyl group may impart additional hydrophobic characteristics, influencing its interaction with biological systems and organic materials. The N-oxide functional group can enhance the compound's reactivity, particularly in oxidation-reduction reactions, and may also affect its biological activity, making it of interest in medicinal chemistry. Additionally, compounds of this nature can exhibit various pharmacological properties, including antimicrobial or anti-inflammatory effects, depending on their specific structure and substituents. Overall, 4-(3-phenylpropyl)pyridine N-oxide represents a unique structure that combines features of both aromatic and heterocyclic chemistry, making it a subject of interest in various fields, including organic synthesis and drug development.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c16-15-11-9-14(10-12-15)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-12H,4,7-8H2
InChI key:OOFBEJNEUVLZOW-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CCCC2=CC=[N+](C=C2)[O-]
Found 3 products.