CymitQuimica logo

CAS 3416-57-7

:

N-acetonylphthalimide

Description:
N-acetonylphthalimide, with the CAS number 3416-57-7, is an organic compound that belongs to the class of phthalimides. It features a phthalimide core, which is a bicyclic structure containing a five-membered imide ring fused to a benzene ring, with an acetonyl group attached to the nitrogen atom of the imide. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in organic solvents such as acetone and ethanol. N-acetonylphthalimide is known for its reactivity, particularly in nucleophilic substitution reactions, making it useful in various synthetic applications. It may also exhibit properties such as stability under standard conditions, but it can be sensitive to moisture and light. Additionally, its derivatives and related compounds are often explored for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their unique chemical properties. As with all chemical substances, proper handling and safety precautions should be observed when working with N-acetonylphthalimide.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-7(13)6-12-10(14)8-4-2-3-5-9(8)11(12)15/h2-5H,6H2,1H3
InChI key:STMRGLKPBJVVEG-UHFFFAOYSA-N
SMILES:CC(=O)CN1C(=O)c2ccccc2C1=O
Synonyms:
  • Phthalimidoacetone
  • 2-(2-oxopropyl)-1H-isoindole-1,3(2H)-dione
Found 5 products.