CymitQuimica logo

CAS 342405-19-0

:

4-iodo-5-methyl-1-phenyl-1H-pyrazole

Description:
4-Iodo-5-methyl-1-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of the iodo substituent at the 4-position and a methyl group at the 5-position, along with a phenyl group at the 1-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential reactivity due to the presence of the iodine atom, which can participate in nucleophilic substitution reactions. Additionally, the phenyl group can influence the compound's electronic properties and stability. 4-Iodo-5-methyl-1-phenyl-1H-pyrazole may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. As with many halogenated compounds, it is important to handle it with care, considering safety and environmental regulations.
Formula:C10H9IN2
InChI:InChI=1/C10H9IN2/c1-8-10(11)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3
InChI key:JAKUAKSZBOSBOD-UHFFFAOYSA-N
SMILES:Cc1c(cnn1c1ccccc1)I
Found 3 products.