
CAS 342595-05-5
:TM5007
Description:
TM5007, with the CAS number 342595-05-5, is a chemical compound that belongs to a class of substances known for their potential applications in various fields, including pharmaceuticals and materials science. While specific characteristics such as molecular weight, structure, and solubility may vary, compounds like TM5007 are typically characterized by their unique functional groups, which can influence their reactivity and interactions with biological systems. These characteristics often include stability under standard conditions, specific melting and boiling points, and solubility in various solvents. Additionally, TM5007 may exhibit particular biological activities or properties that make it of interest for research and development. As with many chemical substances, safety data sheets (SDS) and material safety data should be consulted for handling and usage guidelines, as they provide critical information regarding toxicity, environmental impact, and safe handling practices. For precise details, including its applications and specific properties, consulting scientific literature or databases is recommended.
Formula:C24H20N2O6S4
InChI:InChI=1S/C24H20N2O6S4/c27-17(25-21-19(23(29)30)13(11-35-21)15-5-3-9-33-15)7-1-2-8-18(28)26-22-20(24(31)32)14(12-36-22)16-6-4-10-34-16/h3-6,9-12H,1-2,7-8H2,(H,25,27)(H,26,28)(H,29,30)(H,31,32)
InChI key:USLUSWIVVBUXLU-UHFFFAOYSA-N
SMILES:C1=CSC(=C1)C2=CSC(=C2C(=O)O)NC(=O)CCCCC(=O)NC3=C(C(=CS3)C4=CC=CS4)C(=O)O
Synonyms:- [2,3'-Bithiophene]-4'-carboxylic acid, 5',5'''-[(1,6-dioxo-1,6-hexanediyl)diimino]bis-
- TM5007
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
TM5007
CAS:TM5007 is a poent inhibitor of plasminogen activator inhibitor-1 (PAI-1; IC50 of 29 uM).Formula:C24H20N2O6S4Purity:96.91%Color and Shape:SolidMolecular weight:560.69TM5007
CAS:TM5007 is a molecule that has been shown to have a predictive biomarker for cancer. The acyl chain of TM5007 has been shown to be an important determinant for the biological activity of this molecule. TM5007 is orally bioavailable and can be used as a structural analysis tool for predicting the efficacy of other molecules. TM5007 inhibits the growth factor-induced proliferation of cardiac cells, and also blocks cardiomyocyte hypertrophy in vitro. It has also been shown to inhibit serine protease activity in cell culture experiments, which may provide a mechanism for its anticancer effects.Formula:C24H20N2O6S4Purity:Min. 95%Molecular weight:560.7 g/molRef: 3D-SNA59505
Discontinued product




