CAS 34281-22-6

1,2-Ethane-1,1,2,2-d4-di(amine-d2)(9CI)

Description:

1,2-Ethane-1,1,2,2-d4-di(amine-d2)(9CI), with the CAS number 34281-22-6, is a deuterated derivative of ethylenediamine, which is a simple aliphatic amine. This compound features a backbone of ethane with two amine functional groups (-NH2) attached to the first and second carbon atoms. The presence of deuterium (d) indicates that hydrogen atoms in the molecule have been replaced with deuterium isotopes, which can be useful in various applications, including NMR spectroscopy and tracer studies in chemical research. The deuteration enhances the stability and alters the physical properties of the compound, making it valuable in studies involving reaction mechanisms and molecular interactions. As a diamine, it can participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions and condensation reactions. Its unique isotopic labeling allows for precise tracking in complex chemical environments, contributing to advancements in both organic chemistry and materials science.

Formula: C₂D₈N₂

InChI: InChI=1S/C2H8N2/c3-1-2-4/h1-4H2/i1D2,2D2/hD4

InChI key: PIICEJLVQHRZGT-DMPFXTKESA-N

SMILES: [2H]C([2H])(C([2H])([2H])N([2H])[2H])N([2H])[2H]

Synonyms:

• Ethylenediamine-d8

Ethylenediamine-d8

Controlled Product

CAS: 107-15-3, 34281-22-6

Formula: D₂NCD₂CD₂ND₂

Purity: 97 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 68.11896

Ref: 3U-D5548

Ethylenediamine-d8

Controlled Product

CAS: 34281-22-6

Formula: C₂D₈N₂

Color and Shape: Neat

Molecular weight: 68.1476

Ref: TR-E917696