CAS 34302-69-7
:2,9-Dimethyl-1,10-phenanthroline hemihydrate,98+%
Description:
2,9-Dimethyl-1,10-phenanthroline hemihydrate is an organic compound characterized by its complex aromatic structure, which includes two methyl groups attached to the phenanthroline backbone. This compound is typically used in coordination chemistry and analytical applications, particularly as a ligand for metal ions due to its ability to form stable complexes. The hemihydrate form indicates that the compound contains half a molecule of water per molecule of the anhydrous substance, which can influence its solubility and stability. It is often characterized by its bright color, which can vary depending on the metal complex formed, and exhibits strong absorbance in the UV-Vis spectrum. The compound is generally handled with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during its use in laboratory settings. Its high purity grade (98+%) suggests suitability for sensitive applications, including research and development in fields such as materials science and biochemistry.
Formula:C28H26N4O
InChI:InChI=1/2C14H12N2.H2O/c2*1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h2*3-8H,1-2H3;1H2
SMILES:Cc1ccc2ccc3ccc(C)nc3c2n1.Cc1ccc2ccc3ccc(C)nc3c2n1.O
Synonyms:- 2,9-Dimethyl-1,10-Phenanthroline Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Neocuproine Hemihydrate
CAS:Formula:C14H12N2H2OPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:217.272,9-Dimethyl-1,10-phenanthroline hemihydrate, 98+%
CAS:2,9-Dimethyl-1,10-phenanthroline hemihydrate, is used as a reagent for the spectrophotometric determination of copper. It is used as an intermediate in medicine and chemical research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documen
Formula:C28H26N4OPurity:98+%Color and Shape:Powder, White to creamMolecular weight:434.542,9-Dimethyl-1,10-phenanthroline hemihydrate
CAS:Formula:C27H24N4OPurity:98%Color and Shape:SolidMolecular weight:420.5057Neocuproine hemihydrate
CAS:Formula:C14H12N2·5H2OPurity:99.0 - 101.0 % (dried basis)Color and Shape:White, off-white or faint beige powderMolecular weight:217.272,9-Dimethyl-1,10-phenanthroline hemihydrate
CAS:2,9-Dimethyl-1,10-phenanthroline hemihydratePurity:99%Molecular weight:434.54g/mol2,9-Dimethyl-1,10-phenanthroline hemihydrate
CAS:Chelating agent used to detect aqueous copper ions by electrochemiluminescenceFormula:C14H12N2•(H2O)0Purity:Min. 95%Color and Shape:PowderMolecular weight:217.27 g/mol






