CymitQuimica logo

CAS 34302-69-7

:

2,9-Dimethyl-1,10-phenanthroline hemihydrate,98+%

Description:
2,9-Dimethyl-1,10-phenanthroline hemihydrate is an organic compound characterized by its complex aromatic structure, which includes two methyl groups attached to the phenanthroline backbone. This compound is typically used in coordination chemistry and analytical applications, particularly as a ligand for metal ions due to its ability to form stable complexes. The hemihydrate form indicates that the compound contains half a molecule of water per molecule of the anhydrous substance, which can influence its solubility and stability. It is often characterized by its bright color, which can vary depending on the metal complex formed, and exhibits strong absorbance in the UV-Vis spectrum. The compound is generally handled with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during its use in laboratory settings. Its high purity grade (98+%) suggests suitability for sensitive applications, including research and development in fields such as materials science and biochemistry.
Formula:C28H26N4O
InChI:InChI=1/2C14H12N2.H2O/c2*1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h2*3-8H,1-2H3;1H2
InChI key:IEBXFSLFDFHSRD-UHFFFAOYSA-N
SMILES:Cc1ccc2ccc3ccc(C)nc3c2n1.Cc1ccc2ccc3ccc(C)nc3c2n1.O
Synonyms:
  • 2,9-Dimethyl-1,10-Phenanthroline Hydrate
Found 7 products.