CymitQuimica logo

CAS 34312-77-1

:

trans-2-(2-nitrovinyl)thiophene

Description:
Trans-2-(2-nitrovinyl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a nitrovinyl group at the 2-position of the thiophene ring imparts unique electronic and optical properties, making it of interest in materials science and organic electronics. This compound typically exhibits a yellow to orange color due to its conjugated system, which allows for light absorption in the visible spectrum. It is likely to be a solid at room temperature and may have moderate solubility in organic solvents. The nitro group introduces polarity and can influence the compound's reactivity, making it a potential candidate for further chemical modifications. Additionally, the trans configuration of the nitrovinyl group affects the compound's geometry and electronic distribution, which can be crucial for its applications in organic synthesis and as a building block in the development of functional materials. Safety data should be consulted, as nitro compounds can be hazardous.
Formula:C6H5NO2S
InChI:InChI=1/C6H5NO2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H/b4-3+
InChI key:UTPOWFFIBWOQRK-ONEGZZNKSA-N
SMILES:C1=CSC(=C1)/C=C/[N+](=O)[O-]
Synonyms:
  • 2-[(E)-2-nitroethenyl]thiophene
  • (E)-2-(2-Nitroethenyl)Thiophene
Found 5 products.