CymitQuimica logo

CAS 343321-96-0

:

Propanoic acid,2-methyl-2-[4-[[[[4-methyl-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl]carbonyl]amino]methyl]phenoxy]-

Description:
The chemical substance known as 2-methyl-2-[4-[[[[4-methyl-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl]carbonyl]amino]methyl]phenoxy]-propanoic acid, with the CAS number 343321-96-0, is a complex organic compound characterized by its multi-functional structure. It features a propanoic acid backbone, which is a carboxylic acid known for its acidity and ability to participate in various chemical reactions. The presence of a thiazole ring contributes to its heterocyclic nature, while the trifluoromethyl group enhances its lipophilicity and potential biological activity. The compound also contains multiple aromatic rings, which can influence its stability and reactivity. Such structural features suggest potential applications in pharmaceuticals or agrochemicals, where the compound may exhibit specific biological activities or serve as a building block for further chemical synthesis. Overall, the intricate arrangement of functional groups and rings in this molecule indicates a compound with diverse chemical properties and potential utility in various fields.
Formula:C23H21F3N2O4S
InChI:InChI=1S/C23H21F3N2O4S/c1-13-18(33-20(28-13)15-6-8-16(9-7-15)23(24,25)26)19(29)27-12-14-4-10-17(11-5-14)32-22(2,3)21(30)31/h4-11H,12H2,1-3H3,(H,27,29)(H,30,31)
InChI key:ILUPZUOBHCUBKB-UHFFFAOYSA-N
SMILES:CC1=C(SC(=N1)C2=CC=C(C=C2)C(F)(F)F)C(=O)NCC3=CC=C(C=C3)OC(C)(C)C(=O)O
Found 4 products.