CymitQuimica logo

CAS 34338-96-0

:

(2S,5S)-2,5-Hexanediol

Description:
(2S,5S)-2,5-Hexanediol is a chiral organic compound characterized by its two hydroxyl (-OH) functional groups located at the second and fifth carbon atoms of a six-carbon chain. This diol is a colorless, viscous liquid at room temperature and is soluble in water due to the presence of its hydroxyl groups, which can form hydrogen bonds. Its chirality, indicated by the (2S,5S) configuration, means that it exists in a specific stereoisomeric form, which can influence its reactivity and interactions in biological systems. (2S,5S)-2,5-Hexanediol is often used in the synthesis of various chemical intermediates, surfactants, and as a potential building block in pharmaceuticals and agrochemicals. Additionally, it may exhibit properties such as low volatility and moderate viscosity, making it suitable for applications in formulations where these characteristics are desirable. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H14O2
InChI:InChI=1S/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1
InChI key:OHMBHFSEKCCCBW-WDSKDSINSA-N
SMILES:C[C@@H](CC[C@H](C)O)O
Found 8 products.