CAS 34386-42-0
:1-(4-tert-butylphenyl)ethanol
Description:
1-(4-tert-Butylphenyl)ethanol, with the CAS number 34386-42-0, is an organic compound characterized by its structure, which features a tert-butyl group attached to a phenyl ring, along with a hydroxyl (-OH) group on the ethyl side chain. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits moderate solubility in water due to the presence of the hydroxyl group, while being more soluble in organic solvents. It has a relatively high boiling point compared to simpler alcohols, reflecting its larger molecular size and complexity. The presence of the bulky tert-butyl group contributes to its steric hindrance, which can influence its reactivity and interactions with other molecules. 1-(4-tert-Butylphenyl)ethanol is often studied for its potential applications in organic synthesis and as a building block in the development of various chemical products, including pharmaceuticals and agrochemicals. Its properties make it of interest in both industrial and research settings, particularly in the fields of organic chemistry and materials science.
Formula:C12H18O
InChI:InChI=1/C12H18O/c1-9(13)10-5-7-11(8-6-10)12(2,3)4/h5-9,13H,1-4H3
SMILES:CC(c1ccc(cc1)C(C)(C)C)O
Synonyms:- 1-(p-tert-Butylphenyl)ethanol
- 4-tert-Butyl-.alpha.-methylbenzyl alcohol
- Benzenemethanol, 4- (1,1-dimethylethyl)-.alpha.-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(4-Tert-butylphenyl)ethan-1-ol
CAS:1-(4-Tert-butylphenyl)ethan-1-olPurity:98%Molecular weight:178.27g/mol1-(4-tert-Butylphenyl)ethan-1-ol
CAS:1-(4-tert-Butylphenyl)ethan-1-ol is a reagent, complex compound, useful intermediate, and fine chemical. It has CAS No. 34386-42-0 and is a useful scaffold for the synthesis of speciality chemicals. 1-(4-tert-Butylphenyl)ethan-1-ol is a versatile building block that can be used in the synthesis of many different compounds. It is also an important reaction component for the synthesis of many organic compounds.Formula:C12H18OPurity:Min. 95%Color and Shape:PowderMolecular weight:178.27 g/mol1-(4-tert-Butylphenyl)ethanol
CAS:Controlled ProductFormula:C12H18OColor and Shape:NeatMolecular weight:178.2714-(TERT-BUTYL)-α-METHYLBENZYL ALCOHOL
CAS:Formula:C12H18OPurity:98%Color and Shape:SolidMolecular weight:178.2707




