CymitQuimica logo

CAS 3439-02-9

:

4-Bromo-2-furoic acid

Description:
4-Bromo-2-furoic acid is an aromatic carboxylic acid characterized by the presence of a furan ring and a bromine substituent at the 4-position. Its molecular structure features a five-membered heterocyclic ring containing oxygen, which contributes to its unique reactivity and properties. The carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound is typically a white to off-white solid and is soluble in polar solvents like water and alcohols, owing to the presence of the carboxylic acid group. The bromine atom enhances its electrophilic properties, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 4-bromo-2-furoic acid can serve as a building block for more complex molecules, and its derivatives may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as with many halogenated organic substances.
Formula:C5H3BrO3
InChI:InChI=1S/C5H3BrO3/c6-3-1-4(5(7)8)9-2-3/h1-2H,(H,7,8)
InChI key:QALYBHRYGIXHOF-UHFFFAOYSA-N
SMILES:C1=C(OC=C1Br)C(=O)O
Synonyms:
  • 4-Bromo-2-furancarboxylic acid
Found 4 products.