CAS 343952-33-0
:1-n-Butyl-4-methylpyridinium tetrafluoroborate
Description:
1-n-Butyl-4-methylpyridinium tetrafluoroborate is an ionic liquid characterized by its unique combination of a pyridinium cation and a tetrafluoroborate anion. The cation, 1-n-butyl-4-methylpyridinium, features a butyl group and a methyl group attached to the pyridine ring, which contributes to its solubility and stability. This compound is typically colorless to pale yellow and exhibits low volatility, making it suitable for various applications in organic synthesis and electrochemistry. Its ionic nature imparts high thermal stability and a wide liquid range, allowing it to remain in a liquid state over a broad temperature range. Additionally, it has good ionic conductivity, which is beneficial for use in batteries and supercapacitors. The tetrafluoroborate anion is known for its non-hygroscopic properties, enhancing the stability of the ionic liquid. Overall, 1-n-butyl-4-methylpyridinium tetrafluoroborate is valued for its unique properties that facilitate its use in green chemistry and as a solvent for various chemical reactions.
Formula:C10H16BF4N
InChI:InChI=1/C10H16N.BF4/c1-3-4-7-11-8-5-10(2)6-9-11;2-1(3,4)5/h5-6,8-9H,3-4,7H2,1-2H3;/q+1;-1
InChI key:VISYYHYJMCAKAF-UHFFFAOYSA-N
SMILES:[B-](F)(F)(F)F.CCCC[N+]1=CC=C(C=C1)C
Synonyms:- 1-Butyl-4-methylpyridinium tetrafluoroborate
- N-Butyl-4-Methylpyridinium Tetrafluoroborate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Butyl-4-methylpyridinium Tetrafluoroborate
CAS:Formula:C10H16BF4NPurity:>98.0%(HPLC)Color and Shape:Light yellow to Yellow to Orange clear liquidMolecular weight:237.051-n-Butyl-4-methylpyridinium tetrafluoroborate, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H16BF4NPurity:99%Color and Shape:Colourless to pale yellow, LiquidMolecular weight:237.051-Butyl-4-methylpyridin-1-ium tetrafluoroborate
CAS:Formula:C10H16BF4NPurity:98%Color and Shape:LiquidMolecular weight:237.04541-Butyl-4-Methylpyridinium Tetrafluoroborate
CAS:1-Butyl-4-Methylpyridinium TetrafluoroborateFormula:C10H16BF4NPurity:99%Molecular weight:237.051-Butyl-4-methylpyridin-1-ium tetrafluoroborate
CAS:1-Butyl-4-methylpyridin-1-ium tetrafluoroborateFormula:C10H16BF4NPurity:98%Molecular weight:237.051-Butyl-4-methylpyridin-1-ium tetrafluoroborate
CAS:Purity:98%Color and Shape:LiquidMolecular weight:237.0500031





