CAS 344-07-0
:Chloropentafluorobenzene
Description:
Chloropentafluorobenzene, with the CAS number 344-07-0, is an aromatic compound characterized by a benzene ring substituted with one chlorine atom and five fluorine atoms. This compound is a colorless liquid at room temperature and is known for its high volatility and low viscosity. Its molecular structure imparts significant chemical stability and resistance to oxidation, making it useful in various applications, including as a solvent and in the synthesis of other fluorinated compounds. Chloropentafluorobenzene exhibits unique physical properties, such as a high density and low surface tension, which are influenced by the electronegative fluorine atoms. Additionally, it has a relatively low boiling point compared to other halogenated benzenes. Due to the presence of both chlorine and fluorine, it can participate in various chemical reactions, including nucleophilic substitutions. However, safety precautions are necessary when handling this compound, as it can be harmful if inhaled or ingested, and it may pose environmental risks due to its persistence.
Formula:C6ClF5
InChI:InChI=1S/C6ClF5/c7-1-2(8)4(10)6(12)5(11)3(1)9
InChI key:InChIKey=KGCDGLXSBHJAHZ-UHFFFAOYSA-N
SMILES:ClC1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- 1-Chloro-2,3,4,5,6-pentafluorobenzene
- Benzene, 1-chloro-2,3,4,5,6-pentafluoro-
- Benzene, chloropentafluoro-
- Chloroperfluorobenzene
- NSC 96886
- Pentafluoro-1-chlorobenzene
- Pentafluorochlorobenzene
- Pentafluorophenyl chloride
- Chloropentafluorobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Chloropentafluorobenzene
CAS:Formula:C6ClF5Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:202.51Chloropentafluorobenzene
CAS:Chloropentafluorobenzene is a chemical compound with the formula CClF. It has a high vapor pressure, which makes it a useful solvent for reactions in the liquid phase. The chlorine atoms on the molecule can be replaced by other halogens to produce related compounds. The chloromethyl group is an example of this type of substitution reaction. Chloropentafluorobenzene is not genotoxic and does not react with DNA in vitro, but it can form stable complexes with nucleophiles. This suggests that it may have potential as a therapeutic agent as well as an industrial solvent.
Formula:C6ClF5Purity:Min. 95%Molecular weight:202.51 g/molChloropentafluorobenzene, 99%
CAS:Chloropentafluorobenzene, 99%
Formula:ClC6F5Purity:99%Color and Shape:colorless liq.Molecular weight:202.51Pentafluorochlorobenzene
CAS:PentafluorochlorobenzeneFormula:C6ClF5Purity:99%Color and Shape:Colourless Liquid-ClearMolecular weight:202.50921






