CAS 34402-78-3
:4-methylpyrrole-2-carboxylic acid*methyl ester
Description:
4-Methylpyrrole-2-carboxylic acid methyl ester, with the CAS number 34402-78-3, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a methyl ester functional group, indicating that it is an ester derivative of 4-methylpyrrole-2-carboxylic acid. The presence of the methyl group at the 4-position of the pyrrole ring contributes to its unique chemical properties, including its reactivity and solubility. Typically, compounds of this nature exhibit moderate polarity, making them soluble in polar organic solvents. They may participate in various chemical reactions, such as esterification and nucleophilic substitutions, due to the presence of both the carboxylic acid and ester functionalities. Additionally, 4-methylpyrrole derivatives are of interest in medicinal chemistry and materials science due to their potential biological activities and applications in synthesizing more complex molecules. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-5-3-6(8-4-5)7(9)10-2/h3-4,8H,1-2H3
SMILES:Cc1cc(C(=O)OC)[nH]c1
Synonyms:- Methyl 4-methylpyrrole-2-carboxylate
- Ai3-35111
- 1H-Pyrrole-2-carboxylic acid, 4-methyl-, methyl ester
- methyl 4-methyl-1H-pyrrole-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4-methyl-1H-pyrrole-2-carboxylate
CAS:Methyl 4-methyl-1H-pyrrole-2-carboxylateFormula:C7H9NO2Purity:98%Molecular weight:139.15Methyl 4-methyl-1H-pyrrole-2-carboxylate
CAS:Methyl 4-methyl-1H-pyrrole-2-carboxylateFormula:C7H9NO2Purity:95%Molecular weight:139.15Methyl 4-methyl-1H-pyrrole-2-carboxylate
CAS:Formula:C7H9NO2Purity:95%Color and Shape:SolidMolecular weight:139.1519Methyl 4-Methyl-1H-pyrrole-2-carboxylate
CAS:Formula:C7H9NO2Purity:98%Color and Shape:SolidMolecular weight:139.154Methyl 4-Methylpyrrole-2-carboxylate
CAS:Controlled ProductApplications Methyl 4-Methylpyrrole-2-carboxylate is a useful reagent for preparation of (E)-3-(2-(N-phenylcarbamoyl)vinyl)pyrrole-2-carboxylic acid derivatives, a novel class of glycine site antagonists.
References Balsamini, C., et al.: J. Med. Chem., 41, 808 (1998);Formula:C7H9NO2Color and Shape:NeatMolecular weight:139.152




