![[1,1'-Biphenyl-2,2',3,3',4',5,5',6,6'-d9]-4-amine(9CI)](https://static.cymitquimica.com/cas-image/thumb-webp/231564-11-biphenyl-22-33-4-55-66-d9-4-amine-9ci.webp)
CAS 344298-96-0
:[1,1'-Biphenyl-2,2',3,3',4',5,5',6,6'-d9]-4-amine(9CI)
Description:
[1,1'-Biphenyl-2,2',3,3',4',5,5',6,6'-d9]-4-amine, also known by its CAS number 344298-96-0, is a deuterated derivative of biphenyl with an amine functional group. This compound features a biphenyl structure where specific hydrogen atoms are replaced by deuterium, enhancing its stability and altering its physical properties. The presence of the amine group introduces basicity and potential reactivity, making it useful in various chemical applications, including as a building block in organic synthesis and in the development of pharmaceuticals. The deuteration can also facilitate studies in NMR spectroscopy, allowing for clearer analysis of molecular interactions and dynamics. Additionally, the compound may exhibit unique solubility and melting point characteristics compared to its non-deuterated counterparts. Overall, [1,1'-Biphenyl-2,2',3,3',4',5,5',6,6'-d9]-4-amine is significant in research and industrial applications due to its structural features and isotopic labeling.
Formula:C12H2D9N
InChI:InChI=1S/C12H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,13H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D
InChI key:DMVOXQPQNTYEKQ-LOIXRAQWSA-N
SMILES:[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])N)[2H])[2H])[2H])[2H]
Synonyms:- 4-Aminobiphenyl D9
- 4-Aminodiphenyl-D9
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Aminobiphenyl-d9
CAS:Controlled ProductFormula:C6D5C6D4NH2Purity:98 atom % DColor and Shape:Colorless-Pale Yellow SolidMolecular weight:178.145644-Aminobiphenyl D9 100 µg/mL in Acetone
CAS:Controlled ProductFormula:C12D9H2NColor and Shape:Single SolutionMolecular weight:178.28Deuterated Mix, 3-2135 in Toluene
CAS:Controlled ProductFormula:C10H7H2NColor and Shape:MixtureMolecular weight:150.234-Aminobiphenyl-d9
CAS:Controlled ProductApplications 4-Aminobiphenyl-d9 (CAS# 344298-96-0) is a useful isotopically labeled research compound.
Formula:C12D9H2NColor and Shape:NeatMolecular weight:178.284-Aminobiphenyl-D9
CAS:Controlled Product4-Aminobiphenyl is a chemical compound that belongs to the group of aromatic amines. It is a human carcinogen and has been shown to cause cancer in animals. 4-Aminobiphenyl has been detected in the environment as an environmental pollutant and can be found in small quantities at low levels in food, air, and water. 4-Aminobiphenyl can be hydrolyzed by acid or alkaline hydrolysis to form its hydrolysate, which contains nitroarenes that are not present in the original compound. The DNA modification caused by 4-aminophenol may be due to its ability to modify DNA bases through reactive metabolites such as nitroarenes.
Formula:C12H2D9NPurity:Min. 95%Molecular weight:178.27 g/mol
