CymitQuimica logo

CAS 344298-98-2

:

Pentanoic-2,2,3,3,4,5,5,5-d8acid, 4-(methyl-d3)- (9CI)

Description:
Pentanoic-2,2,3,3,4,5,5,5-d8 acid, 4-(methyl-d3)-, is a deuterated derivative of pentanoic acid, characterized by the presence of deuterium atoms replacing specific hydrogen atoms in its molecular structure. This compound is part of a class of fatty acids and is notable for its use in various research applications, particularly in studies involving isotopic labeling. The presence of deuterium enhances the compound's stability and alters its physical properties, making it useful in nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques. The methyl-d3 group indicates that one of the methyl groups in the structure is also deuterated, which can further assist in tracing metabolic pathways or studying reaction mechanisms. As a chemical substance, it is typically handled with standard laboratory safety protocols, and its applications may extend to fields such as biochemistry, pharmacology, and materials science. Its unique isotopic composition allows for precise tracking in complex biological systems or chemical reactions.
Formula:C6HD11O2
InChI:InChI=1S/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/i1D3,2D3,3D2,4D2,5D
InChI key:FGKJLKRYENPLQH-KUXNVAAFSA-N
SMILES:[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C(=O)O
Synonyms:
  • 4-Methylpentanoic-D11 Acid
  • (iso-Caproic Acid)(4-Methylvaleric Acid)
Found 3 products.