CAS 3445-11-2
:1-(2-Hydroxyethyl)-2-pyrrolidinone
Description:
1-(2-Hydroxyethyl)-2-pyrrolidinone, also known as HEPP, is a cyclic amide characterized by its five-membered ring structure containing a nitrogen atom. It features a hydroxyl group and an ethyl side chain, which contribute to its solubility in water and organic solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits hygroscopic properties, meaning it can absorb moisture from the environment. HEPP is known for its ability to act as a solvent and a stabilizer in various chemical formulations, particularly in the pharmaceutical and cosmetic industries. Additionally, it has potential applications in drug delivery systems due to its biocompatibility and ability to enhance the solubility of poorly soluble drugs. The compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 1-(2-Hydroxyethyl)-2-pyrrolidinone is valued for its multifunctional properties in diverse chemical contexts.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c8-5-4-7-3-1-2-6(7)9/h8H,1-5H2
InChI key:InChIKey=WDQFELCEOPFLCZ-UHFFFAOYSA-N
SMILES:C(CO)N1C(=O)CCC1
Synonyms:- (2-Hydroxyethyl)-2-Pyrrolidone
- 1-(2-Hydroxyethyl)-2-Pyrrolidinon
- 1-(2-Hydroxyethyl)-2-Pyrrolidinone
- 1-(2-Hydroxyethyl)-2-Pyrrolidone
- 1-(2-Hydroxyethyl)-2-oxopyrrolidine
- 1-(2-Hydroxyethyl)Pyrrolidin-2-One
- 1-(2-Hydroxylethyl)-2-pyrrolidone
- 1-(β-Hydroxyethyl)-2-pyrrolidone
- 2-(2-Oxopyrrolidin-1-yl)ethanol
- 2-Hydroxyethylpyrrolidin-2-one
- 2-Pyrrolidinone, 1-(2-hydroxyethyl)-
- N-(2-Hydroxyethyl)pyrrolidone
- N-(2-hydroxyethyl)-2-Pyrrolidinone
- N-(β-Hydroxyethyl)-2-pyrrolidinone
- N-(β-Hydroxyethyl)-2-pyrrolidone
- N-2-Hydroxyethylpyrrolidin-2-one-
- N-Hydroxyethyl Pyrrolidone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(2-Hydroxyethyl)-2-pyrrolidone
CAS:Formula:C6H11NO2Purity:>98.0%(GC)Color and Shape:White or Colorles to Yellow to Orange powder to lump to clear liquidMolecular weight:129.161-(2-hydroxyethyl)pyrrolidin-2-one
CAS:Formula:C6H11NO2Purity:98%Color and Shape:LiquidMolecular weight:129.1570N-(2-Hydroxyethyl)-2-pyrrolidone
CAS:N-(2-Hydroxyethyl)-2-pyrrolidoneFormula:C6H11NO2Purity:98%Molecular weight:129.16N-(2-Hydroxyethyl)-2-pyrrolidone
CAS:N-(2-Hydroxyethyl)-2-pyrrolidone is a fatty alcohol that is used as a solvent and plasticizer. It has been shown to inhibit the synthesis of fatty acids by inhibiting the enzyme, hepg2, in mammalian cell culture. N-(2-Hydroxyethyl)-2-pyrrolidone also enhances the rate of dehydration of polymers. This effect can be attributed to its ability to form hydrogen bonds with the polymer backbone, which is known to enhance the rate of polymer degradation. The optimal reaction temperature for N-(2-Hydroxyethyl)-2-pyrrolidone is at pH 2 and at polymer concentration of 1%.
Formula:C6H11NO2Purity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:129.16 g/mol1-(2-Hydroxyethyl)pyrrolidin-2-one
CAS:Formula:C6H11NO2Purity:97.0%Color and Shape:SolidMolecular weight:129.159





