CAS 34539-84-9

6,7-Dehydroferruginol

Description:

6,7-Dehydroferruginol is a naturally occurring chemical compound classified as a terpenoid, specifically a type of sesquiterpene. It is derived from various plant sources and is known for its structural complexity, featuring multiple rings and functional groups. The compound exhibits a unique arrangement of carbon atoms, contributing to its distinctive chemical properties. 6,7-Dehydroferruginol has garnered interest in the field of medicinal chemistry due to its potential biological activities, including anti-inflammatory and antimicrobial effects. Its molecular structure allows for interactions with biological targets, making it a subject of research for therapeutic applications. Additionally, this compound may play a role in plant defense mechanisms, contributing to the ecological interactions within its native environments. As with many natural products, the extraction and purification of 6,7-Dehydroferruginol can be challenging, necessitating advanced techniques in organic chemistry for its study and application. Overall, its unique characteristics and potential benefits make it a noteworthy compound in both natural product chemistry and pharmacology.

Formula: C₂₀H₂₈O

InChI: InChI=1S/C20H28O/c1-13(2)15-11-14-7-8-18-19(3,4)9-6-10-20(18,5)16(14)12-17(15)21/h7-8,11-13,18,21H,6,9-10H2,1-5H3/t18-,20+/m0/s1

InChI key: InChIKey=NCHINJPZLGMLCY-AZUAARDMSA-N

SMILES: C[C@@]12C=3C(=CC(C(C)C)=C(O)C3)C=C[C@]1(C(C)(C)CCC2)[H]

Synonyms:

• 3-Phenanthrenol, 4b,5,6,7,8,8a-hexahydro-4b,8,8-trimethyl-2-(1-methylethyl)-, (4bS-trans)-
• 3-Phenanthrenol, 4b,5,6,7,8,8a-hexahydro-4b,8,8-trimethyl-2-(1-methylethyl)-, (4bS,8aS)-
• Podocarpa-6,8,11,13-tetraen-12-ol, 13-isopropyl-
• (4bS,8aS)-4b,5,6,7,8,8a-Hexahydro-4b,8,8-trimethyl-2-(1-methylethyl)-3-phenanthrenol
• Ferruginol, 9-dehydro-

6,7-Dehydroferruginol

CAS: 34539-84-9

6,7-Dehydroferruginol is a useful organic compound for research related to life sciences and the catalog number is T124991.

Formula: C₂₀H₂₈O

Color and Shape: Solid

Molecular weight: 284.4357

Ref: TM-T124991

6,7-Dehydroferruginol

CAS: 34539-84-9

6,7-Dehydroferruginol is a diterpenoid compound, which is a type of organic chemical structure characterized by its four isoprene units forming a 20-carbon skeleton. This compound is typically derived from natural sources, specifically coniferous plants such as those belonging to the genus *Abies*. The mode of action of 6,7-Dehydroferruginol involves modulation of various biological pathways, often through interactions with cellular receptors and enzymes that can influence physiological processes.

Formula: C₂₀H₂₈O

Purity: Min. 95%

Molecular weight: 284.40 g/mol

Ref: 3D-JBA53984