CAS 34598-33-9
:4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic acid
Description:
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic acid, commonly referred to as a perfluorinated compound, is characterized by its fully fluorinated carbon chain, which imparts unique properties such as high thermal stability, chemical resistance, and low surface tension. This compound features a long carbon backbone with multiple fluorine atoms, making it hydrophobic and lipophobic, which contributes to its potential applications in various industries, including coatings and surfactants. Its structure leads to significant environmental persistence and bioaccumulation concerns, as it does not easily degrade in the environment. The presence of the carboxylic acid functional group allows for potential interactions with other chemical species, although the fluorinated nature of the molecule limits its solubility in water. Due to its unique properties, this compound has been studied for its effects on human health and the environment, leading to increased regulatory scrutiny and research into safer alternatives.
Formula:C11H5F17O2
InChI:InChI=1S/C11H5F17O2/c12-4(13,2-1-3(29)30)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h1-2H2,(H,29,30)
InChI key:InChIKey=JZRCRCFPVAXHHQ-UHFFFAOYSA-N
SMILES:C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(CCC(O)=O)(F)F)(F)F)(F)F)(F)F
Synonyms:- 2H,2H,3H,3H-Perfluoroundecanoic acid
- 3-Perfluorooctylpropionic acid
- 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic acid
- Heptadecafluoroundecanoic acid
- Undecanoic acid, 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2H,2H,3H,3H-Heptadecafluoroundecanoic Acid
CAS:Controlled ProductFormula:C11H5F17O2Purity:>97.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:492.132H.2H.3H.3H-Perfluoroundecanoic acid (4HPFUnA) (Standard)
CAS:Controlled Product2H.2H.3H.3H-Perfluoroundecanoic acid (4HPFUnA) (Standard) is a reference standard of 2H.2H.3H.3H-Perfluoroundecanoic acid (4HPFUnA) intended for quantitative analysis, quality control, and related biochemical research applications.Formula:C11H5F17O2Color and Shape:SolidMolecular weight:492.1292H,2H,3H,3H-Perfluoroundecanoic acid
CAS:Controlled ProductFormula:C11H5F17O2Color and Shape:NeatMolecular weight:492.132H,2H,3H,3H-Perfluoroundecanoic acid 50 µg/mL in Methanol
CAS:Controlled ProductFormula:C11H5F17O2Color and Shape:Single SolutionMolecular weight:492.134,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic Acid
CAS:Controlled ProductApplications 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic Acid is a derivative of Undecanoic Acid (U788850) which is a saturated fatty acid. It may be used to activate orphan G protein-coupled receptor GPR40.
References Briscoe, C., et al.: J. Biol. Chem., 278, 11303 (2003)Formula:C11H5F17O2Color and Shape:NeatMolecular weight:492.134,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic Acid
CAS:Controlled ProductFormula:C11H5F17O2Molecular weight:492.132H.2H.3H.3H-Perfluoroundecanoic acid (4HPFUnA)
CAS:Controlled ProductFormula:C11H5F17O2Molecular weight:492.134,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic acid
CAS:Controlled Product4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic acidFormula:C11H5F17O2Purity:98%Molecular weight:492.13







