CAS 345984-11-4
:1-butyl-1-methylpyrrolidinium fluoride trifluoroborane (1:1)
Description:
1-Butyl-1-methylpyrrolidinium fluoride trifluoroborane (1:1), with the CAS number 345984-11-4, is an ionic liquid characterized by its unique combination of a pyrrolidinium cation and a trifluoroborate anion. This substance typically exhibits low volatility, high thermal stability, and a wide liquid range, making it suitable for various applications in organic synthesis and electrochemistry. The presence of the butyl and methyl groups in the cation contributes to its solubility in organic solvents and enhances its ionic conductivity. Additionally, the trifluoroborate anion imparts unique reactivity and stability, which can be advantageous in catalytic processes. The ionic nature of this compound allows it to dissolve a range of polar and nonpolar substances, making it a versatile solvent. Its properties make it an attractive candidate for use in energy storage systems, such as batteries and supercapacitors, as well as in the development of advanced materials. Overall, 1-butyl-1-methylpyrrolidinium fluoride trifluoroborane (1:1) represents a significant advancement in the field of ionic liquids.
Formula:C9H20BF4N
InChI:InChI=1/C9H20N.BF3.FH/c1-3-4-7-10(2)8-5-6-9-10;2-1(3)4;/h3-9H2,1-2H3;;1H/q+1;;/p-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Butyl-1-methylpyrrolidinium Tetrafluoroborate
CAS:Formula:C9H20BF4NPurity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:229.07N-Butyl-1-methylpyrrolidinium tetrafluoroborate
CAS:N-Butyl-1-methylpyrrolidinium tetrafluoroborateFormula:C9H20N·BF4Purity:98%Color and Shape:Solid-PowderMolecular weight:229.066411-Butyl-1-methylpyrrolidinium tetrafluoroborate
CAS:Formula:C9H20BF4NPurity:96%Color and Shape:SolidMolecular weight:229.06641-Butyl-1-Methylpyrrolidinium Tetrafluoroborate (BMP BF4) extrapure, 97%
CAS:Formula:C9H20BF4NPurity:min. 97%Color and Shape:White to pale beige, CompoundMolecular weight:229.07




