CAS 345987-15-7
:(2E)-1,3-benzothiazol-2(3H)-ylidene{2-[(2-pyridin-3-ylethyl)amino]pyrimidin-4-yl}ethanenitrile
Description:
The chemical substance known as (2E)-1,3-benzothiazol-2(3H)-ylidene{2-[(2-pyridin-3-ylethyl)amino]pyrimidin-4-yl}ethanenitrile, with the CAS number 345987-15-7, is a complex organic compound characterized by its unique structural features. It contains a benzothiazole moiety, which is a fused ring system that contributes to its aromatic properties and potential biological activity. The presence of a pyrimidine ring and a pyridine substituent suggests that this compound may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in various biological systems. The ethylene nitrile group indicates potential reactivity, which could be exploited in synthetic applications or in the development of pharmaceuticals. Additionally, the compound's structure suggests it may engage in hydrogen bonding and π-π stacking interactions, which are important in biological contexts. Overall, this compound's intricate structure and functional groups make it a candidate for further investigation in medicinal chemistry and material science.
Formula:C20H16N6S
InChI:InChI=1/C20H16N6S/c21-12-15(19-25-17-5-1-2-6-18(17)27-19)16-8-11-24-20(26-16)23-10-7-14-4-3-9-22-13-14/h1-6,8-9,11,13,25H,7,10H2,(H,23,24,26)/b19-15-
SMILES:c1ccc2c(c1)[nH]/c(=C(\C#N)/c1cc[nH]c(=NCCc3cccnc3)n1)/s2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
AS601245
CAS:AS601245 is an inhibitor of the c-Jun NH2-terminal kinase (JNK), with neuroprotective properties.Formula:C20H16N6SPurity:98% - 99.02%Color and Shape:SolidMolecular weight:372.45JNK Inhibitor V
CAS:JNK Inhibitor V is a small molecule inhibitor, which is a synthetic compound with selective inhibitory activity against the c-Jun N-terminal kinase (JNK) pathway. It acts by specifically targeting the JNK enzymes, thereby blocking their interaction with downstream substrates involved in various cellular processes. The inhibition of JNK activity by JNK Inhibitor V mitigates the phosphorylation of c-Jun and other transcription factors, ultimately influencing gene expression and cellular responses.
Formula:C20H16N6SPurity:Min. 95%Molecular weight:372.45 g/mol



