CAS 347-84-2
:4'-Fluoro-2-phenylacetophenone
Description:
4'-Fluoro-2-phenylacetophenone, with the CAS number 347-84-2, is an organic compound belonging to the class of ketones. It features a phenyl group and a fluoro substituent on the aromatic ring, which contributes to its chemical properties and reactivity. This compound typically appears as a solid at room temperature and is characterized by its white to light yellow crystalline form. It has a relatively high melting point and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The presence of the fluoro group enhances its electrophilic character, making it useful in various chemical reactions, including Friedel-Crafts acylation and as an intermediate in organic synthesis. Additionally, 4'-Fluoro-2-phenylacetophenone can exhibit photochemical properties, making it valuable in applications such as photoinitiators in polymerization processes. As with many organic compounds, handling should be done with care, following appropriate safety protocols due to potential toxicity and environmental impact.
Formula:C14H11FO
InChI:InChI=1/C14H11FO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2
SMILES:c1ccc(cc1)CC(=O)c1ccc(cc1)F
Synonyms:- 1-(4-Fluorophenyl)-2-phenylethanone
- Benzyl-4-fluorophenyl ketone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzyl 4-Fluorophenyl Ketone
CAS:Formula:C14H11FOPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:214.241-(4-Fluorophenyl)-2-phenylethanone
CAS:1-(4-Fluorophenyl)-2-phenylethanoneFormula:C14H11FOPurity:99%Color and Shape:Pale yellow SolidMolecular weight:214.234941-(4-Fluorophenyl)-2-phenylethanone
CAS:Formula:C14H11FOPurity:98%Color and Shape:SolidMolecular weight:214.2349Benzyl 4-Fluorophenyl Ketone
CAS:Controlled ProductApplications Benzyl 4-Fluorophenyl Ketone is used in the preparation and evaluation of 2,3-diarylpyrazines and quinoxalines as selective COX-2 inhibitors.
References Singh, S. et al.: Bioorg. Med. Chem., 12, 1881 (2004);Formula:C14H11FOColor and Shape:NeatMolecular weight:214.234′-Fluoro-2-phenylacetophenone
CAS:Formula:C14H11FOPurity:97%Color and Shape:SolidMolecular weight:214.239





