CymitQuimica logo

CAS 347174-28-1

:

Benzoic acid, 4-bromo-3-methyl-, 1,1-dimethylethyl ester

Description:
Benzoic acid, 4-bromo-3-methyl-, 1,1-dimethylethyl ester, with the CAS number 347174-28-1, is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and an alcohol. This compound features a bromine atom and a methyl group on the benzene ring, contributing to its unique chemical properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound may exhibit biological activity, potentially serving as an intermediate in organic synthesis or as a building block in pharmaceuticals. Its structure suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitution. Additionally, the bromine substituent can influence the reactivity and stability of the compound, making it of interest in both synthetic and medicinal chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C12H15BrO2
InChI:InChI=1S/C12H15BrO2/c1-8-7-9(5-6-10(8)13)11(14)15-12(2,3)4/h5-7H,1-4H3
InChI key:RIHBTHGKWXRWQX-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)C(=O)OC(C)(C)C)Br
Synonyms:
  • 2-Methyl-2-Propanyl 4-Bromo-3-Methylbenzoate
Found 4 products.