CymitQuimica logo

CAS 347389-74-6

:

1,3,2-Dioxaborolane, 2-ethynyl-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-ethynyl-4,4,5,5-tetramethyl- is an organoboron compound characterized by its unique dioxaborolane ring structure, which features a five-membered cyclic arrangement containing two oxygen atoms and a boron atom. This compound typically exhibits a high degree of stability due to the presence of the boron atom, which can participate in various chemical reactions, including cross-coupling reactions that are valuable in organic synthesis. The ethynyl group contributes to its reactivity, allowing for further functionalization and incorporation into larger molecular frameworks. Additionally, the presence of tetramethyl substituents enhances its steric bulk, influencing its solubility and reactivity profile. This compound is of interest in materials science and organic chemistry, particularly in the development of boron-containing polymers and as intermediates in the synthesis of more complex organic molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used in experiments.
Formula:C8H13BO2
InChI:InChI=1S/C8H13BO2/c1-6-9-10-7(2,3)8(4,5)11-9/h1H,2-5H3
InChI key:ZEOXJIIUMORBNN-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C#C
Synonyms:
  • Ethynylboronic Acid Pinacol Ester
Found 5 products.